C18H22O6 — CID 90830026
ethyl 4-acetyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]-5-oxohept-6-enoate (PubChem CID 90830026) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is ethyl 4-acetyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]-5-oxohept-6-enoate.
| Compound Name | ethyl 4-acetyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 90830026 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethyl 4-acetyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]-5-oxohept-6-enoate |
| SMILES | CCOC(=O)CCC(C(C)=O)C(=O)C=Cc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C18H22O6/c1-3-24-18(23)9-6-15(12(2)20)17(22)8-5-13-4-7-16(21)14(10-13)11-19/h4-5,7-8,10,15,19,21H,3,6,9,11H2,1-2H3 |
| InChIKey | ZISKVWHOERARHS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|