C28H32O4 — CID 122497079
[3-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate (PubChem CID 122497079) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is [3-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate.
| Compound Name | [3-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 122497079 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [3-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
| SMILES | C=CC(C)(/C=C/c1cccc(OC(=O)/C=C/c2ccc(O)c(CO)c2)c1)CCC=C(C)C |
| InChI | InChI=1S/C28H32O4/c1-5-28(4,16-7-8-21(2)3)17-15-22-9-6-10-25(19-22)32-27(31)14-12-23-11-13-26(30)24(18-23)20-29/h5-6,8-15,17-19,29-30H,1,7,16,20H2,2-4H3/b14-12+,17-15+ |
| InChIKey | ZZIUOCUDQVJJET-FAHPUHHFSA-N |
| XLogP | 6.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|