C28H18N2O3 — CID 171920339
2-[5-[2-(1,3-benzodioxol-5-yl)ethynyl]-2-pyridinyl]-5-[2-(3-methoxyphenyl)ethynyl]pyridine (PubChem CID 171920339) has the molecular formula C28H18N2O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[5-[2-(1,3-benzodioxol-5-yl)ethynyl]-2-pyridinyl]-5-[2-(3-methoxyphenyl)ethynyl]pyridine.
| Compound Name | 2-[5-[2-(1,3-benzodioxol-5-yl)ethynyl]-2-pyridinyl]-5-[2-(3-methoxyphenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 171920339 |
| Molecular Formula | C28H18N2O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-[5-[2-(1,3-benzodioxol-5-yl)ethynyl]-2-pyridinyl]-5-[2-(3-methoxyphenyl)ethynyl]pyridine |
| SMILES | COc1cccc(C#Cc2ccc(-c3ccc(C#Cc4ccc5c(c4)OCO5)cn3)nc2)c1 |
| InChI | InChI=1S/C28H18N2O3/c1-31-24-4-2-3-20(15-24)5-7-22-9-12-25(29-17-22)26-13-10-23(18-30-26)8-6-21-11-14-27-28(16-21)33-19-32-27/h2-4,9-18H,19H2,1H3 |
| InChIKey | UFRNKDOKOCZHGA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|