C24H20F2O3 — CID 176587058
6-[2-(3,5-difluoro-4-pentoxyphenyl)ethynyl]naphthalene-2-carboxylic acid (PubChem CID 176587058) has the molecular formula C24H20F2O3 and a molecular weight of 394.42 g/mol. Its IUPAC name is 6-[2-(3,5-difluoro-4-pentoxyphenyl)ethynyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[2-(3,5-difluoro-4-pentoxyphenyl)ethynyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 176587058 |
| Molecular Formula | C24H20F2O3 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 6-[2-(3,5-difluoro-4-pentoxyphenyl)ethynyl]naphthalene-2-carboxylic acid |
| SMILES | CCCCCOc1c(F)cc(C#Cc2ccc3cc(C(=O)O)ccc3c2)cc1F |
| InChI | InChI=1S/C24H20F2O3/c1-2-3-4-11-29-23-21(25)13-17(14-22(23)26)6-5-16-7-8-19-15-20(24(27)28)10-9-18(19)12-16/h7-10,12-15H,2-4,11H2,1H3,(H,27,28) |
| InChIKey | VNDCZQKPKYAIJF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|