C25H22F2O3 — CID 176587016
6-[2-(2,5-difluoro-4-hexoxyphenyl)ethynyl]naphthalene-2-carboxylic acid (PubChem CID 176587016) has the molecular formula C25H22F2O3 and a molecular weight of 408.44 g/mol. Its IUPAC name is 6-[2-(2,5-difluoro-4-hexoxyphenyl)ethynyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[2-(2,5-difluoro-4-hexoxyphenyl)ethynyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 176587016 |
| Molecular Formula | C25H22F2O3 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-[2-(2,5-difluoro-4-hexoxyphenyl)ethynyl]naphthalene-2-carboxylic acid |
| SMILES | CCCCCCOc1cc(F)c(C#Cc2ccc3cc(C(=O)O)ccc3c2)cc1F |
| InChI | InChI=1S/C25H22F2O3/c1-2-3-4-5-12-30-24-16-22(26)20(15-23(24)27)9-7-17-6-8-19-14-21(25(28)29)11-10-18(19)13-17/h6,8,10-11,13-16H,2-5,12H2,1H3,(H,28,29) |
| InChIKey | TZPWALBULQACRU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|