C22H24N2 — CID 87960510
1-butyl-4-[4-diazo-1-(4-ethylphenyl)buta-1,3-dienyl]benzene (PubChem CID 87960510) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-butyl-4-[4-diazo-1-(4-ethylphenyl)buta-1,3-dienyl]benzene.
| Compound Name | 1-butyl-4-[4-diazo-1-(4-ethylphenyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 87960510 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-butyl-4-[4-diazo-1-(4-ethylphenyl)buta-1,3-dienyl]benzene |
| SMILES | CCCCc1ccc(C(=CC=C=[N+]=[N-])c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C22H24N2/c1-3-5-7-19-11-15-21(16-12-19)22(8-6-17-24-23)20-13-9-18(4-2)10-14-20/h6,8-16H,3-5,7H2,1-2H3 |
| InChIKey | GXGVQNYIPWSFIR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|