C30H40N2 — CID 87958816
1-butyl-4-[2-(2-diazoethenyl)-1-(3-hexylphenyl)hex-1-enyl]benzene (PubChem CID 87958816) has the molecular formula C30H40N2 and a molecular weight of 428.66 g/mol. Its IUPAC name is 1-butyl-4-[2-(2-diazoethenyl)-1-(3-hexylphenyl)hex-1-enyl]benzene.
| Compound Name | 1-butyl-4-[2-(2-diazoethenyl)-1-(3-hexylphenyl)hex-1-enyl]benzene |
|---|---|
| PubChem CID | 87958816 |
| Molecular Formula | C30H40N2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 1-butyl-4-[2-(2-diazoethenyl)-1-(3-hexylphenyl)hex-1-enyl]benzene |
| SMILES | CCCCCCc1cccc(C(=C(C=C=[N+]=[N-])CCCC)c2ccc(CCCC)cc2)c1 |
| InChI | InChI=1S/C30H40N2/c1-4-7-10-11-14-26-15-12-17-29(24-26)30(27(16-9-6-3)22-23-32-31)28-20-18-25(19-21-28)13-8-5-2/h12,15,17-22,24H,4-11,13-14,16H2,1-3H3 |
| InChIKey | CPIRCPYLTJMRMO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|