C34H48N2Ni — CID 87959089
1-butyl-4-[3-(diazomethylidene)-2-pentyl-1-(3-pentylphenyl)hept-1-enyl]benzene;nickel (PubChem CID 87959089) has the molecular formula C34H48N2Ni and a molecular weight of 543.47 g/mol. Its IUPAC name is 1-butyl-4-[3-(diazomethylidene)-2-pentyl-1-(3-pentylphenyl)hept-1-enyl]benzene;nickel.
| Compound Name | 1-butyl-4-[3-(diazomethylidene)-2-pentyl-1-(3-pentylphenyl)hept-1-enyl]benzene;nickel |
|---|---|
| PubChem CID | 87959089 |
| Molecular Formula | C34H48N2Ni |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 1-butyl-4-[3-(diazomethylidene)-2-pentyl-1-(3-pentylphenyl)hept-1-enyl]benzene;nickel |
| SMILES | CCCCCC(C(=C=[N+]=[N-])CCCC)=C(c1ccc(CCCC)cc1)c1cccc(CCCCC)c1.[Ni] |
| InChI | InChI=1S/C34H48N2.Ni/c1-5-9-13-17-29-18-15-20-31(26-29)34(30-24-22-28(23-25-30)16-11-7-3)33(21-14-10-6-2)32(27-36-35)19-12-8-4;/h15,18,20,22-26H,5-14,16-17,19,21H2,1-4H3; |
| InChIKey | YBTXTJFGOKWPPG-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|