C31H38N2 — CID 87959799
1-butyl-4-[2-butyl-3-(diazomethylidene)-1-(3-prop-1-ynylphenyl)hept-1-enyl]benzene (PubChem CID 87959799) has the molecular formula C31H38N2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 1-butyl-4-[2-butyl-3-(diazomethylidene)-1-(3-prop-1-ynylphenyl)hept-1-enyl]benzene.
| Compound Name | 1-butyl-4-[2-butyl-3-(diazomethylidene)-1-(3-prop-1-ynylphenyl)hept-1-enyl]benzene |
|---|---|
| PubChem CID | 87959799 |
| Molecular Formula | C31H38N2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1-butyl-4-[2-butyl-3-(diazomethylidene)-1-(3-prop-1-ynylphenyl)hept-1-enyl]benzene |
| SMILES | CC#Cc1cccc(C(=C(CCCC)C(=C=[N+]=[N-])CCCC)c2ccc(CCCC)cc2)c1 |
| InChI | InChI=1S/C31H38N2/c1-5-9-14-25-19-21-27(22-20-25)31(28-17-12-15-26(23-28)13-8-4)30(18-11-7-3)29(24-33-32)16-10-6-2/h12,15,17,19-23H,5-7,9-11,14,16,18H2,1-4H3 |
| InChIKey | PRBSULHCQFGQKN-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|