C28H36N2 — CID 87959285
1-butyl-3-[1-(4-butylphenyl)-3-(diazomethylidene)-2-ethylpent-1-enyl]benzene (PubChem CID 87959285) has the molecular formula C28H36N2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-butyl-3-[1-(4-butylphenyl)-3-(diazomethylidene)-2-ethylpent-1-enyl]benzene.
| Compound Name | 1-butyl-3-[1-(4-butylphenyl)-3-(diazomethylidene)-2-ethylpent-1-enyl]benzene |
|---|---|
| PubChem CID | 87959285 |
| Molecular Formula | C28H36N2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 1-butyl-3-[1-(4-butylphenyl)-3-(diazomethylidene)-2-ethylpent-1-enyl]benzene |
| SMILES | CCCCc1ccc(C(=C(CC)C(=C=[N+]=[N-])CC)c2cccc(CCCC)c2)cc1 |
| InChI | InChI=1S/C28H36N2/c1-5-9-12-22-16-18-25(19-17-22)28(27(8-4)24(7-3)21-30-29)26-15-11-14-23(20-26)13-10-6-2/h11,14-20H,5-10,12-13H2,1-4H3 |
| InChIKey | FIMYXZXMDQADOK-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|