C44H68N2Ni — CID 173203293
5-[2-(2-diazoethenyl)-1-(3,4,5-tripentylphenyl)hex-1-enyl]-1,2,3-tripropylbenzene;nickel (PubChem CID 173203293) has the molecular formula C44H68N2Ni and a molecular weight of 683.74 g/mol. Its IUPAC name is 5-[2-(2-diazoethenyl)-1-(3,4,5-tripentylphenyl)hex-1-enyl]-1,2,3-tripropylbenzene;nickel.
| Compound Name | 5-[2-(2-diazoethenyl)-1-(3,4,5-tripentylphenyl)hex-1-enyl]-1,2,3-tripropylbenzene;nickel |
|---|---|
| PubChem CID | 173203293 |
| Molecular Formula | C44H68N2Ni |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 682.47 |
| IUPAC Name | 5-[2-(2-diazoethenyl)-1-(3,4,5-tripentylphenyl)hex-1-enyl]-1,2,3-tripropylbenzene;nickel |
| SMILES | CCCCCc1cc(C(=C(C=C=[N+]=[N-])CCCC)c2cc(CCC)c(CCC)c(CCC)c2)cc(CCCCC)c1CCCCC.[Ni] |
| InChI | InChI=1S/C44H68N2.Ni/c1-8-15-19-26-38-33-41(34-39(27-20-16-9-2)43(38)28-21-17-10-3)44(35(25-18-11-4)29-30-46-45)40-31-36(22-12-5)42(24-14-7)37(32-40)23-13-6;/h29,31-34H,8-28H2,1-7H3; |
| InChIKey | WSNXBLFPJYVXJM-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|