C59H98N2 — CID 87959844
5-[3-(diazomethylidene)-2-pentyl-1-(3,4,5-trihexylphenyl)oct-1-enyl]-1,2,3-tripentylbenzene (PubChem CID 87959844) has the molecular formula C59H98N2 and a molecular weight of 835.45 g/mol. Its IUPAC name is 5-[3-(diazomethylidene)-2-pentyl-1-(3,4,5-trihexylphenyl)oct-1-enyl]-1,2,3-tripentylbenzene.
| Compound Name | 5-[3-(diazomethylidene)-2-pentyl-1-(3,4,5-trihexylphenyl)oct-1-enyl]-1,2,3-tripentylbenzene |
|---|---|
| PubChem CID | 87959844 |
| Molecular Formula | C59H98N2 |
| Molecular Weight | 835.45 g/mol |
| Exact Mass | 834.77 |
| IUPAC Name | 5-[3-(diazomethylidene)-2-pentyl-1-(3,4,5-trihexylphenyl)oct-1-enyl]-1,2,3-tripentylbenzene |
| SMILES | CCCCCCc1cc(C(=C(CCCCC)C(=C=[N+]=[N-])CCCCC)c2cc(CCCCC)c(CCCCC)c(CCCCC)c2)cc(CCCCCC)c1CCCCCC |
| InChI | InChI=1S/C59H98N2/c1-9-17-25-33-38-51-46-55(47-52(39-34-26-18-10-2)57(51)42-35-27-19-11-3)59(58(43-32-24-16-8)53(48-61-60)40-30-22-14-6)54-44-49(36-28-20-12-4)56(41-31-23-15-7)50(45-54)37-29-21-13-5/h44-47H,9-43H2,1-8H3 |
| InChIKey | TXQTYDWZWDYQFG-UHFFFAOYSA-N |
| XLogP | 19.04 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 38 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.45 |
| LogP ≤ 5 | 19.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|