C39H53BN2 — CID 54763150
1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(2Z)-3-(4-methylphenyl)hexa-2,5-dien-2-yl]-1,3,2-diazaborolidine (PubChem CID 54763150) has the molecular formula C39H53BN2 and a molecular weight of 560.68 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(2Z)-3-(4-methylphenyl)hexa-2,5-dien-2-yl]-1,3,2-diazaborolidine.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(2Z)-3-(4-methylphenyl)hexa-2,5-dien-2-yl]-1,3,2-diazaborolidine |
|---|---|
| PubChem CID | 54763150 |
| Molecular Formula | C39H53BN2 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.43 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[(2Z)-3-(4-methylphenyl)hexa-2,5-dien-2-yl]-1,3,2-diazaborolidine |
| SMILES | C=CC/C(=C(/C)B1N(c2c(C(C)C)cccc2C(C)C)CCN1c1c(C(C)C)cccc1C(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C39H53BN2/c1-12-15-37(32-22-20-30(10)21-23-32)31(11)40-41(38-33(26(2)3)16-13-17-34(38)27(4)5)24-25-42(40)39-35(28(6)7)18-14-19-36(39)29(8)9/h12-14,16-23,26-29H,1,15,24-25H2,2-11H3/b37-31+ |
| InChIKey | IZBCFQLYXARTJJ-USLOJTSYSA-N |
| XLogP | 10.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|