C40H52N2 — CID 46187115
1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-methyl-1-(4-methylphenyl)pent-3-enylidene]imidazole (PubChem CID 46187115) has the molecular formula C40H52N2 and a molecular weight of 560.87 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-methyl-1-(4-methylphenyl)pent-3-enylidene]imidazole.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-methyl-1-(4-methylphenyl)pent-3-enylidene]imidazole |
|---|---|
| PubChem CID | 46187115 |
| Molecular Formula | C40H52N2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-methyl-1-(4-methylphenyl)pent-3-enylidene]imidazole |
| SMILES | CC(C)=CCC(=C1N(c2c(C(C)C)cccc2C(C)C)C=CN1c1c(C(C)C)cccc1C(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C40H52N2/c1-26(2)18-23-37(32-21-19-31(11)20-22-32)40-41(38-33(27(3)4)14-12-15-34(38)28(5)6)24-25-42(40)39-35(29(7)8)16-13-17-36(39)30(9)10/h12-22,24-25,27-30H,23H2,1-11H3 |
| InChIKey | MBLVXKCPTMJGSQ-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|