C35H46AgN2O2 — CID 132941200
CID 132941200 (PubChem CID 132941200) has the molecular formula C35H46AgN2O2 and a molecular weight of 634.63 g/mol.
| Compound Name | CID 132941200 |
|---|---|
| PubChem CID | 132941200 |
| Molecular Formula | C35H46AgN2O2 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[CH]N(c2c(C(C)C)cccc2C(C)C)CC1.Cc1ccc(C(=O)[O-])cc1.[Ag+] |
| InChI | InChI=1S/C27H39N2.C8H8O2.Ag/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-6-2-4-7(5-3-6)8(9)10;/h9-14,17-21H,15-16H2,1-8H3;2-5H,1H3,(H,9,10);/q;;+1/p-1 |
| InChIKey | ORJMTPAQTGPART-UHFFFAOYSA-M |
| XLogP | 7.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |