C24H22 — CID 12007048
[(1E,4Z)-4,5-diphenylhexa-1,4-dienyl]benzene (PubChem CID 12007048) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is [(1E,4Z)-4,5-diphenylhexa-1,4-dienyl]benzene.
| Compound Name | [(1E,4Z)-4,5-diphenylhexa-1,4-dienyl]benzene |
|---|---|
| PubChem CID | 12007048 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(1E,4Z)-4,5-diphenylhexa-1,4-dienyl]benzene |
| SMILES | C/C(=C(\C/C=C/c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22/c1-20(22-15-7-3-8-16-22)24(23-17-9-4-10-18-23)19-11-14-21-12-5-2-6-13-21/h2-18H,19H2,1H3/b14-11+,24-20- |
| InChIKey | DPCJCHXKZINRDQ-MBZGHTCYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|