C29H22O3 — CID 159186909
1,5-dihydroxy-1,2,4,5-tetraphenylpenta-1,4-dien-3-one (PubChem CID 159186909) has the molecular formula C29H22O3 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1,5-dihydroxy-1,2,4,5-tetraphenylpenta-1,4-dien-3-one.
| Compound Name | 1,5-dihydroxy-1,2,4,5-tetraphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 159186909 |
| Molecular Formula | C29H22O3 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1,5-dihydroxy-1,2,4,5-tetraphenylpenta-1,4-dien-3-one |
| SMILES | O=C(C(=C(O)c1ccccc1)c1ccccc1)C(=C(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22O3/c30-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)29(32)26(22-15-7-2-8-16-22)28(31)24-19-11-4-12-20-24/h1-20,30-31H |
| InChIKey | KNPIMQLJBWURPG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|