2,3-dihydroxy-3-phenylprop-2-enoic acid

C9H8O4 — CID 66595634

IUPAC2,3-dihydroxy-3-phenylprop-2-enoic acid
SMILESO=C(O)C(O)=C(O)c1ccccc1
InChIInChI=1S/C9H8O4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,10-11H,(H,12,13)
InChIKeyDRBARRGCABOUIE-UHFFFAOYSA-N
MW180.16 g/mol
LogP1.56
Rot. Bonds2

About 2,3-dihydroxy-3-phenylprop-2-enoic acid

2,3-dihydroxy-3-phenylprop-2-enoic acid (PubChem CID 66595634) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,3-dihydroxy-3-phenylprop-2-enoic acid.

Molecular Properties

Compound Name2,3-dihydroxy-3-phenylprop-2-enoic acid
PubChem CID66595634
Molecular FormulaC9H8O4
Molecular Weight180.16 g/mol
Exact Mass180.04
IUPAC Name2,3-dihydroxy-3-phenylprop-2-enoic acid
SMILESO=C(O)C(O)=C(O)c1ccccc1
InChIInChI=1S/C9H8O4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,10-11H,(H,12,13)
InChIKeyDRBARRGCABOUIE-UHFFFAOYSA-N
XLogP1.56
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,3-dihydroxy-3-phenylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-3-phenylprop-2-enoic acid?
The IUPAC name of 2,3-dihydroxy-3-phenylprop-2-enoic acid (CID 66595634) is 2,3-dihydroxy-3-phenylprop-2-enoic acid.
What is the SMILES notation for 2,3-dihydroxy-3-phenylprop-2-enoic acid?
The canonical SMILES for 2,3-dihydroxy-3-phenylprop-2-enoic acid is O=C(O)C(O)=C(O)c1ccccc1.
What is the InChIKey of 2,3-dihydroxy-3-phenylprop-2-enoic acid?
The InChIKey is DRBARRGCABOUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,10-11H,(H,12,13).
What are the key properties of 2,3-dihydroxy-3-phenylprop-2-enoic acid?
2,3-dihydroxy-3-phenylprop-2-enoic acid has a molecular weight of 180.16 g/mol, XLogP of 1.56, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-3-phenylprop-2-enoic acid is sourced from PubChem (CID 66595634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).