C21H22O — CID 102387925
2-methyl-5,5-diphenyl-3-prop-1-en-2-ylpenta-3,4-dien-2-ol (PubChem CID 102387925) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-methyl-5,5-diphenyl-3-prop-1-en-2-ylpenta-3,4-dien-2-ol.
| Compound Name | 2-methyl-5,5-diphenyl-3-prop-1-en-2-ylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 102387925 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-methyl-5,5-diphenyl-3-prop-1-en-2-ylpenta-3,4-dien-2-ol |
| SMILES | C=C(C)C(=C=C(c1ccccc1)c1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C21H22O/c1-16(2)20(21(3,4)22)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,22H,1H2,2-4H3 |
| InChIKey | TZYQKHHYPOVQTQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|