C18H18O — CID 606056
2-methyl-5,5-diphenylpenta-3,4-dien-2-ol (PubChem CID 606056) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-methyl-5,5-diphenylpenta-3,4-dien-2-ol.
| Compound Name | 2-methyl-5,5-diphenylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 606056 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-methyl-5,5-diphenylpenta-3,4-dien-2-ol |
| SMILES | CC(C)(O)C=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-18(2,19)14-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,19H,1-2H3 |
| InChIKey | VQRONOOJRBWMGE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |