C12H12O2 — CID 101044559
2-hydroxy-2-methyl-1-phenylpenta-3,4-dien-1-one (PubChem CID 101044559) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-phenylpenta-3,4-dien-1-one.
| Compound Name | 2-hydroxy-2-methyl-1-phenylpenta-3,4-dien-1-one |
|---|---|
| PubChem CID | 101044559 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-hydroxy-2-methyl-1-phenylpenta-3,4-dien-1-one |
| SMILES | C=C=CC(C)(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-3-9-12(2,14)11(13)10-7-5-4-6-8-10/h4-9,14H,1H2,2H3 |
| InChIKey | JNSZFJCBORBBGR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |