C15H22OSn — CID 15504471
2,2-dimethyl-1-phenyl-3-trimethylstannylbut-3-en-1-one (PubChem CID 15504471) has the molecular formula C15H22OSn and a molecular weight of 337.05 g/mol. Its IUPAC name is 2,2-dimethyl-1-phenyl-3-trimethylstannylbut-3-en-1-one.
| Compound Name | 2,2-dimethyl-1-phenyl-3-trimethylstannylbut-3-en-1-one |
|---|---|
| PubChem CID | 15504471 |
| Molecular Formula | C15H22OSn |
| Molecular Weight | 337.05 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2,2-dimethyl-1-phenyl-3-trimethylstannylbut-3-en-1-one |
| SMILES | C=C(C(C)(C)C(=O)c1ccccc1)[Sn](C)(C)C |
| InChI | InChI=1S/C12H13O.3CH3.Sn/c1-4-12(2,3)11(13)10-8-6-5-7-9-10;;;;/h5-9H,1H2,2-3H3;3*1H3; |
| InChIKey | QCHJJUQRPBOUSW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |