C10H10Br2 — CID 166642881
1-[(Z)-2,3-dibromoprop-1-enyl]-3-methylbenzene (PubChem CID 166642881) has the molecular formula C10H10Br2 and a molecular weight of 290.00 g/mol. Its IUPAC name is 1-[(Z)-2,3-dibromoprop-1-enyl]-3-methylbenzene.
| Compound Name | 1-[(Z)-2,3-dibromoprop-1-enyl]-3-methylbenzene |
|---|---|
| PubChem CID | 166642881 |
| Molecular Formula | C10H10Br2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 1-[(Z)-2,3-dibromoprop-1-enyl]-3-methylbenzene |
| SMILES | Cc1cccc(/C=C(\Br)CBr)c1 |
| InChI | InChI=1S/C10H10Br2/c1-8-3-2-4-9(5-8)6-10(12)7-11/h2-6H,7H2,1H3/b10-6- |
| InChIKey | HJRIZGPGOHVWRA-POHAHGRESA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|