About (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine
(Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine (PubChem CID 178168748) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine |
| PubChem CID | 178168748 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine |
| SMILES | CNC/C(=C/c1cccc(C)c1)NC |
| InChI | InChI=1S/C12H18N2/c1-10-5-4-6-11(7-10)8-12(14-3)9-13-2/h4-8,13-14H,9H2,1-3H3/b12-8- |
| InChIKey | NTOOPEWZXREVPH-WQLSENKSSA-N |
| XLogP | 1.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine?
The IUPAC name of (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine (CID 178168748) is (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine is CNC/C(=C/c1cccc(C)c1)NC.
What is the InChIKey of (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine?
The InChIKey is NTOOPEWZXREVPH-WQLSENKSSA-N. The full InChI is InChI=1S/C12H18N2/c1-10-5-4-6-11(7-10)8-12(14-3)9-13-2/h4-8,13-14H,9H2,1-3H3/b12-8-.
What are the key properties of (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine?
(Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine has a molecular weight of 190.29 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N,2-N-dimethyl-3-(3-methylphenyl)prop-2-ene-1,2-diamine is sourced from PubChem (CID 178168748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).