C11H14BrN — CID 79340471
3-(3-bromophenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 79340471) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 3-(3-bromophenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79340471 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-(3-bromophenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | CNCC(C)=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C11H14BrN/c1-9(8-13-2)6-10-4-3-5-11(12)7-10/h3-7,13H,8H2,1-2H3 |
| InChIKey | JOEQQHPLTPZUAJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |