C19H36INO3S — CID 130457024
2-(15-iodopentadecanoylamino)-4-sulfanylbutanoic acid (PubChem CID 130457024) has the molecular formula C19H36INO3S and a molecular weight of 485.47 g/mol. Its IUPAC name is 2-(15-iodopentadecanoylamino)-4-sulfanylbutanoic acid.
| Compound Name | 2-(15-iodopentadecanoylamino)-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 130457024 |
| Molecular Formula | C19H36INO3S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-(15-iodopentadecanoylamino)-4-sulfanylbutanoic acid |
| SMILES | O=C(CCCCCCCCCCCCCCI)NC(CCS)C(=O)O |
| InChI | InChI=1S/C19H36INO3S/c20-15-12-10-8-6-4-2-1-3-5-7-9-11-13-18(22)21-17(14-16-25)19(23)24/h17,25H,1-16H2,(H,21,22)(H,23,24) |
| InChIKey | XNOQMYGHPIVHGL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|