C21H42N4O4 — CID 166964540
tert-butyl N-[5-amino-6-oxo-6-[[5-oxo-5-(pentan-2-ylamino)pentan-2-yl]amino]hexyl]carbamate (PubChem CID 166964540) has the molecular formula C21H42N4O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is tert-butyl N-[5-amino-6-oxo-6-[[5-oxo-5-(pentan-2-ylamino)pentan-2-yl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-6-oxo-6-[[5-oxo-5-(pentan-2-ylamino)pentan-2-yl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 166964540 |
| Molecular Formula | C21H42N4O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | tert-butyl N-[5-amino-6-oxo-6-[[5-oxo-5-(pentan-2-ylamino)pentan-2-yl]amino]hexyl]carbamate |
| SMILES | CCCC(C)NC(=O)CCC(C)NC(=O)C(N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H42N4O4/c1-7-10-15(2)24-18(26)13-12-16(3)25-19(27)17(22)11-8-9-14-23-20(28)29-21(4,5)6/h15-17H,7-14,22H2,1-6H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | TUQYWLONHKKFRJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|