C16H32N6O3 — CID 175903925
tert-butyl N-[(2S)-1-(3-azidopropylamino)-6-(dimethylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 175903925) has the molecular formula C16H32N6O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-azidopropylamino)-6-(dimethylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-azidopropylamino)-6-(dimethylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 175903925 |
| Molecular Formula | C16H32N6O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-azidopropylamino)-6-(dimethylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CN(C)CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H32N6O3/c1-16(2,3)25-15(24)20-13(9-6-7-12-22(4)5)14(23)18-10-8-11-19-21-17/h13H,6-12H2,1-5H3,(H,18,23)(H,20,24)/t13-/m0/s1 |
| InChIKey | JXWOQSMFSDYVRI-ZDUSSCGKSA-N |
| XLogP | 2.43 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|