C21H42N6O4 — CID 167610444
tert-butyl N-[(2R)-6-[[1-azido-5-(dimethylamino)-2,2-dimethylpentan-3-yl]oxycarbonylamino]hexan-2-yl]carbamate (PubChem CID 167610444) has the molecular formula C21H42N6O4 and a molecular weight of 442.61 g/mol. Its IUPAC name is tert-butyl N-[(2R)-6-[[1-azido-5-(dimethylamino)-2,2-dimethylpentan-3-yl]oxycarbonylamino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-6-[[1-azido-5-(dimethylamino)-2,2-dimethylpentan-3-yl]oxycarbonylamino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 167610444 |
| Molecular Formula | C21H42N6O4 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | tert-butyl N-[(2R)-6-[[1-azido-5-(dimethylamino)-2,2-dimethylpentan-3-yl]oxycarbonylamino]hexan-2-yl]carbamate |
| SMILES | C[C@H](CCCCNC(=O)OC(CCN(C)C)C(C)(C)CN=[N+]=[N-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H42N6O4/c1-16(25-19(29)31-20(2,3)4)11-9-10-13-23-18(28)30-17(12-14-27(7)8)21(5,6)15-24-26-22/h16-17H,9-15H2,1-8H3,(H,23,28)(H,25,29)/t16-,17?/m1/s1 |
| InChIKey | IHQVVMCRHQSLHF-TZHYSIJRSA-N |
| XLogP | 4.45 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|