C6H24Cl4N4O3 — CID 173221930
5-amino-6-hydroxyhexane-2,4-dione;azane;tetrahydrochloride (PubChem CID 173221930) has the molecular formula C6H24Cl4N4O3 and a molecular weight of 342.10 g/mol. Its IUPAC name is 5-amino-6-hydroxyhexane-2,4-dione;azane;tetrahydrochloride.
| Compound Name | 5-amino-6-hydroxyhexane-2,4-dione;azane;tetrahydrochloride |
|---|---|
| PubChem CID | 173221930 |
| Molecular Formula | C6H24Cl4N4O3 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 5-amino-6-hydroxyhexane-2,4-dione;azane;tetrahydrochloride |
| SMILES | CC(=O)CC(=O)C(N)CO.Cl.Cl.Cl.Cl.N.N.N |
| InChI | InChI=1S/C6H11NO3.4ClH.3H3N/c1-4(9)2-6(10)5(7)3-8;;;;;;;/h5,8H,2-3,7H2,1H3;4*1H;3*1H3 |
| InChIKey | TWDLDQFMLNSZDU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 185.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|