C18H35N3O3 — CID 148549445
(2S)-2-amino-N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]-4-methylpentanamide (PubChem CID 148549445) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 148549445 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | (2S)-2-amino-N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]-4-methylpentanamide |
| SMILES | CCCC[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C18H35N3O3/c1-6-7-8-15(21-18(24)14(20)10-12(4)5)17(23)16(22)13(19)9-11(2)3/h11-15H,6-10,19-20H2,1-5H3,(H,21,24)/t13-,14-,15-/m0/s1 |
| InChIKey | SIIZRXLYARBPPD-KKUMJFAQSA-N |
| XLogP | 1.55 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|