C17H32N2O4 — CID 57126060
tert-butyl N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]carbamate (PubChem CID 57126060) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]carbamate |
|---|---|
| PubChem CID | 57126060 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl N-[(5S,8S)-8-amino-10-methyl-6,7-dioxoundecan-5-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C17H32N2O4/c1-7-8-9-13(19-16(22)23-17(4,5)6)15(21)14(20)12(18)10-11(2)3/h11-13H,7-10,18H2,1-6H3,(H,19,22)/t12-,13-/m0/s1 |
| InChIKey | JEAINYPSFLLXHT-STQMWFEESA-N |
| XLogP | 2.58 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|