C22H43N11O7 — CID 118154796
(2S)-2-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]-N-[4-[[2-[2-(4-hydrazinyl-2,3-dioxobutyl)hydrazinyl]acetyl]amino]-2,3-dioxobutyl]-4-methylpentanamide (PubChem CID 118154796) has the molecular formula C22H43N11O7 and a molecular weight of 573.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]-N-[4-[[2-[2-(4-hydrazinyl-2,3-dioxobutyl)hydrazinyl]acetyl]amino]-2,3-dioxobutyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]-N-[4-[[2-[2-(4-hydrazinyl-2,3-dioxobutyl)hydrazinyl]acetyl]amino]-2,3-dioxobutyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 118154796 |
| Molecular Formula | C22H43N11O7 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]-N-[4-[[2-[2-(4-hydrazinyl-2,3-dioxobutyl)hydrazinyl]acetyl]amino]-2,3-dioxobutyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCCNC(N)N)C(=O)NCC(=O)C(=O)CNC(=O)CNNCC(=O)C(=O)CNN |
| InChI | InChI=1S/C22H43N11O7/c1-12(2)6-14(33-20(39)13(23)4-3-5-27-22(24)25)21(40)29-8-16(35)15(34)7-28-19(38)11-32-31-10-18(37)17(36)9-30-26/h12-14,22,27,30-32H,3-11,23-26H2,1-2H3,(H,28,38)(H,29,40)(H,33,39)/t13-,14-/m0/s1 |
| InChIKey | KXZRENLVHGNHCT-KBPBESRZSA-N |
| XLogP | -6.52 |
| TPSA | 307.78 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | -6.52 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|