C15H32N4O3S — CID 118028297
(2S)-2,6-diamino-N-[(2S)-1-(3-hydroxysulfanylpropylamino)-4-methyl-1-oxopentan-2-yl]hexanamide (PubChem CID 118028297) has the molecular formula C15H32N4O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-(3-hydroxysulfanylpropylamino)-4-methyl-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-(3-hydroxysulfanylpropylamino)-4-methyl-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 118028297 |
| Molecular Formula | C15H32N4O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-(3-hydroxysulfanylpropylamino)-4-methyl-1-oxopentan-2-yl]hexanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)NCCCSO |
| InChI | InChI=1S/C15H32N4O3S/c1-11(2)10-13(15(21)18-8-5-9-23-22)19-14(20)12(17)6-3-4-7-16/h11-13,22H,3-10,16-17H2,1-2H3,(H,18,21)(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | YYPGXRZFJOFEMB-STQMWFEESA-N |
| XLogP | 0.69 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|