C23H48N2O6 — CID 86588604
2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)propanoic acid (PubChem CID 86588604) has the molecular formula C23H48N2O6 and a molecular weight of 448.65 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)propanoic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)propanoic acid |
|---|---|
| PubChem CID | 86588604 |
| Molecular Formula | C23H48N2O6 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(tetradecanoylamino)propanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@@H](C)C(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C17H33NO3.C6H15NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(19)18-15(2)17(20)21;8-4-1-7(2-5-9)3-6-10/h15H,3-14H2,1-2H3,(H,18,19)(H,20,21);8-10H,1-6H2/t15-;/m0./s1 |
| InChIKey | HHXJYWZGLTXKRH-RSAXXLAASA-N |
| XLogP | 2.54 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|