C22H46N2O6 — CID 158271638
2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(2-oxotridecylamino)propanoic acid (PubChem CID 158271638) has the molecular formula C22H46N2O6 and a molecular weight of 434.62 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(2-oxotridecylamino)propanoic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(2-oxotridecylamino)propanoic acid |
|---|---|
| PubChem CID | 158271638 |
| Molecular Formula | C22H46N2O6 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(2S)-2-(2-oxotridecylamino)propanoic acid |
| SMILES | CCCCCCCCCCCC(=O)CN[C@@H](C)C(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C16H31NO3.C6H15NO3/c1-3-4-5-6-7-8-9-10-11-12-15(18)13-17-14(2)16(19)20;8-4-1-7(2-5-9)3-6-10/h14,17H,3-13H2,1-2H3,(H,19,20);8-10H,1-6H2/t14-;/m0./s1 |
| InChIKey | GJCIGHXFSCQUCP-UQKRIMTDSA-N |
| XLogP | 1.80 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|