C23H47N3O7 — CID 76956107
(2S)-5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 76956107) has the molecular formula C23H47N3O7 and a molecular weight of 477.64 g/mol. Its IUPAC name is (2S)-5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol.
| Compound Name | (2S)-5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 76956107 |
| Molecular Formula | C23H47N3O7 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | (2S)-5-amino-2-(dodecanoylamino)-5-oxopentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C17H32N2O4.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-16(21)19-14(17(22)23)12-13-15(18)20;8-4-1-7(2-5-9)3-6-10/h14H,2-13H2,1H3,(H2,18,20)(H,19,21)(H,22,23);8-10H,1-6H2/t14-;/m0./s1 |
| InChIKey | VJXHHZGMJLFNDQ-UQKRIMTDSA-N |
| XLogP | 1.01 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|