C7H13NO4S — CID 107823395
(2R)-4-hydroxy-2-[(2-methylsulfanylacetyl)amino]butanoic acid (PubChem CID 107823395) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(2-methylsulfanylacetyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(2-methylsulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107823395 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (2R)-4-hydroxy-2-[(2-methylsulfanylacetyl)amino]butanoic acid |
| SMILES | CSCC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C7H13NO4S/c1-13-4-6(10)8-5(2-3-9)7(11)12/h5,9H,2-4H2,1H3,(H,8,10)(H,11,12)/t5-/m1/s1 |
| InChIKey | IYQOAIFMECSXKG-RXMQYKEDSA-N |
| XLogP | -0.70 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |