C7H13FN2O3 — CID 20508335
methyl 3-[(2-aminoacetyl)amino]-4-fluorobutanoate (PubChem CID 20508335) has the molecular formula C7H13FN2O3 and a molecular weight of 192.19 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-4-fluorobutanoate.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-4-fluorobutanoate |
|---|---|
| PubChem CID | 20508335 |
| Molecular Formula | C7H13FN2O3 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-4-fluorobutanoate |
| SMILES | COC(=O)CC(CF)NC(=O)CN |
| InChI | InChI=1S/C7H13FN2O3/c1-13-7(12)2-5(3-8)10-6(11)4-9/h5H,2-4,9H2,1H3,(H,10,11) |
| InChIKey | VBQYRHABHLSUMA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |