C7H14N2O2S — CID 123738859
2-amino-N-[(2S)-1-oxo-3-sulfanylpropan-2-yl]butanamide (PubChem CID 123738859) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-amino-N-[(2S)-1-oxo-3-sulfanylpropan-2-yl]butanamide.
| Compound Name | 2-amino-N-[(2S)-1-oxo-3-sulfanylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 123738859 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-amino-N-[(2S)-1-oxo-3-sulfanylpropan-2-yl]butanamide |
| SMILES | CCC(N)C(=O)N[C@@H](C=O)CS |
| InChI | InChI=1S/C7H14N2O2S/c1-2-6(8)7(11)9-5(3-10)4-12/h3,5-6,12H,2,4,8H2,1H3,(H,9,11)/t5-,6?/m0/s1 |
| InChIKey | XHYSKFAFXQOYNW-ZBHICJROSA-N |
| XLogP | -0.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|