C8H15NO4 — CID 89349325
(2S)-2-(formyloxymethylamino)-3,3-dimethylbutanoic acid (PubChem CID 89349325) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (2S)-2-(formyloxymethylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(formyloxymethylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 89349325 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (2S)-2-(formyloxymethylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NCOC=O)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)6(7(11)12)9-4-13-5-10/h5-6,9H,4H2,1-3H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | BFMLQJDKBPZMGM-ZCFIWIBFSA-N |
| XLogP | 0.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|