C9H19NO4 — CID 122494316
(2S)-2-(3-hydroxypropoxyamino)-3,3-dimethylbutanoic acid (PubChem CID 122494316) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is (2S)-2-(3-hydroxypropoxyamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(3-hydroxypropoxyamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122494316 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2S)-2-(3-hydroxypropoxyamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NOCCCO)C(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-9(2,3)7(8(12)13)10-14-6-4-5-11/h7,10-11H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | BXURYYMWFYKKAP-SSDOTTSWSA-N |
| XLogP | 0.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|