C8H9NO6 — CID 146286791
(2R)-2-(prop-2-ynoxycarbonylamino)butanedioic acid (PubChem CID 146286791) has the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. Its IUPAC name is (2R)-2-(prop-2-ynoxycarbonylamino)butanedioic acid.
| Compound Name | (2R)-2-(prop-2-ynoxycarbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 146286791 |
| Molecular Formula | C8H9NO6 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | (2R)-2-(prop-2-ynoxycarbonylamino)butanedioic acid |
| SMILES | C#CCOC(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H9NO6/c1-2-3-15-8(14)9-5(7(12)13)4-6(10)11/h1,5H,3-4H2,(H,9,14)(H,10,11)(H,12,13)/t5-/m1/s1 |
| InChIKey | BNIHQITYDDIKDO-RXMQYKEDSA-N |
| XLogP | -0.73 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|