C9H12N2O5 — CID 129381095
(2S)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]pent-4-ynoic acid (PubChem CID 129381095) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]pent-4-ynoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 129381095 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]pent-4-ynoic acid |
| SMILES | C#CC[C@H](NC(=O)[C@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H12N2O5/c1-2-3-6(9(15)16)11-8(14)5(10)4-7(12)13/h1,5-6H,3-4,10H2,(H,11,14)(H,12,13)(H,15,16)/t5-,6+/m1/s1 |
| InChIKey | WIHFMPVINVRCJZ-RITPCOANSA-N |
| XLogP | -1.62 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|