C9H13ClN2O5 — CID 139211089
2-[(2-amino-3-carboxypropanoyl)amino]pent-4-ynoic acid;hydrochloride (PubChem CID 139211089) has the molecular formula C9H13ClN2O5 and a molecular weight of 264.66 g/mol. Its IUPAC name is 2-[(2-amino-3-carboxypropanoyl)amino]pent-4-ynoic acid;hydrochloride.
| Compound Name | 2-[(2-amino-3-carboxypropanoyl)amino]pent-4-ynoic acid;hydrochloride |
|---|---|
| PubChem CID | 139211089 |
| Molecular Formula | C9H13ClN2O5 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-[(2-amino-3-carboxypropanoyl)amino]pent-4-ynoic acid;hydrochloride |
| SMILES | C#CCC(NC(=O)C(N)CC(=O)O)C(=O)O.Cl |
| InChI | InChI=1S/C9H12N2O5.ClH/c1-2-3-6(9(15)16)11-8(14)5(10)4-7(12)13;/h1,5-6H,3-4,10H2,(H,11,14)(H,12,13)(H,15,16);1H |
| InChIKey | SDOSUZAFWJGEAY-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|