C24H50N4O4 — CID 19360445
ditert-butyl 2-amino-2-[3-[6-(4-aminobutylamino)hexylamino]propyl]propanedioate (PubChem CID 19360445) has the molecular formula C24H50N4O4 and a molecular weight of 458.69 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-[3-[6-(4-aminobutylamino)hexylamino]propyl]propanedioate.
| Compound Name | ditert-butyl 2-amino-2-[3-[6-(4-aminobutylamino)hexylamino]propyl]propanedioate |
|---|---|
| PubChem CID | 19360445 |
| Molecular Formula | C24H50N4O4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | ditert-butyl 2-amino-2-[3-[6-(4-aminobutylamino)hexylamino]propyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCNCCCCCCNCCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H50N4O4/c1-22(2,3)31-20(29)24(26,21(30)32-23(4,5)6)14-13-19-28-17-11-8-7-10-16-27-18-12-9-15-25/h27-28H,7-19,25-26H2,1-6H3 |
| InChIKey | GTHFWCJETIRUPG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|