C23H34N2O+2 — CID 7479408
1-[4-(4-benzylphenoxy)butyl]-4-ethylpiperazine-1,4-diium (PubChem CID 7479408) has the molecular formula C23H34N2O+2 and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-[4-(4-benzylphenoxy)butyl]-4-ethylpiperazine-1,4-diium.
| Compound Name | 1-[4-(4-benzylphenoxy)butyl]-4-ethylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7479408 |
| Molecular Formula | C23H34N2O+2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 1-[4-(4-benzylphenoxy)butyl]-4-ethylpiperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](CCCCOc2ccc(Cc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H32N2O/c1-2-24-15-17-25(18-16-24)14-6-7-19-26-23-12-10-22(11-13-23)20-21-8-4-3-5-9-21/h3-5,8-13H,2,6-7,14-20H2,1H3/p+2 |
| InChIKey | XJJPHTPVDQCBER-UHFFFAOYSA-P |
| XLogP | 1.24 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|