C14H23IN2O+2 — CID 7479388
1-ethyl-4-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium (PubChem CID 7479388) has the molecular formula C14H23IN2O+2 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-ethyl-4-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7479388 |
| Molecular Formula | C14H23IN2O+2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-ethyl-4-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](CCOc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C14H21IN2O/c1-2-16-7-9-17(10-8-16)11-12-18-14-5-3-13(15)4-6-14/h3-6H,2,7-12H2,1H3/p+2 |
| InChIKey | WEYRDWWFCJYKOR-UHFFFAOYSA-P |
| XLogP | -0.53 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|