C18H24Cl2N2O3S — CID 38168445
2-cyclohexyl-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 38168445) has the molecular formula C18H24Cl2N2O3S and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-cyclohexyl-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 38168445 |
| Molecular Formula | C18H24Cl2N2O3S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-cyclohexyl-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H24Cl2N2O3S/c19-15-6-7-16(20)17(13-15)26(24,25)22-10-8-21(9-11-22)18(23)12-14-4-2-1-3-5-14/h6-7,13-14H,1-5,8-12H2 |
| InChIKey | YEGPJNRRJHRRQT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |