C24H22N2O4 — CID 41311295
2-[(E)-3-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]-3-oxoprop-1-enyl]benzonitrile (PubChem CID 41311295) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[(E)-3-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 2-[(E)-3-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 41311295 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[(E)-3-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)piperidin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccccc1/C=C/C(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C24H22N2O4/c25-16-20-4-2-1-3-17(20)6-8-23(27)26-11-9-18(10-12-26)24(28)19-5-7-21-22(15-19)30-14-13-29-21/h1-8,15,18H,9-14H2/b8-6+ |
| InChIKey | VLCWOGRJERVMMA-SOFGYWHQSA-N |
| XLogP | 3.46 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|